About (2E)-hepta-2,6-dienoyl chloride
(2E)-hepta-2,6-dienoyl chloride (PubChem CID 11147795) has the molecular formula C7H9ClO
and a molecular weight of 144.60 g/mol. Its IUPAC name is (2E)-hepta-2,6-dienoyl chloride.
Molecular Properties
| Compound Name | (2E)-hepta-2,6-dienoyl chloride |
| PubChem CID | 11147795 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | (2E)-hepta-2,6-dienoyl chloride |
| SMILES | C=CCC/C=C/C(=O)Cl |
| InChI | InChI=1S/C7H9ClO/c1-2-3-4-5-6-7(8)9/h2,5-6H,1,3-4H2/b6-5+ |
| InChIKey | PNKJKQDBLZIVFE-AATRIKPKSA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-hepta-2,6-dienoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-hepta-2,6-dienoyl chloride?
The IUPAC name of (2E)-hepta-2,6-dienoyl chloride (CID 11147795) is (2E)-hepta-2,6-dienoyl chloride.
What is the SMILES notation for (2E)-hepta-2,6-dienoyl chloride?
The canonical SMILES for (2E)-hepta-2,6-dienoyl chloride is C=CCC/C=C/C(=O)Cl.
What is the InChIKey of (2E)-hepta-2,6-dienoyl chloride?
The InChIKey is PNKJKQDBLZIVFE-AATRIKPKSA-N. The full InChI is InChI=1S/C7H9ClO/c1-2-3-4-5-6-7(8)9/h2,5-6H,1,3-4H2/b6-5+.
What are the key properties of (2E)-hepta-2,6-dienoyl chloride?
(2E)-hepta-2,6-dienoyl chloride has a molecular weight of 144.60 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-hepta-2,6-dienoyl chloride is sourced from PubChem (CID 11147795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).