About 7-amino-3H-1,3-benzoxazol-2-one
7-amino-3H-1,3-benzoxazol-2-one (PubChem CID 11147814) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 7-amino-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 7-amino-3H-1,3-benzoxazol-2-one |
| PubChem CID | 11147814 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 7-amino-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cccc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C7H6N2O2/c8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,8H2,(H,9,10) |
| InChIKey | CLCPWTXGFUIRJE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-3H-1,3-benzoxazol-2-one?
The IUPAC name of 7-amino-3H-1,3-benzoxazol-2-one (CID 11147814) is 7-amino-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 7-amino-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 7-amino-3H-1,3-benzoxazol-2-one is Nc1cccc2[nH]c(=O)oc12.
What is the InChIKey of 7-amino-3H-1,3-benzoxazol-2-one?
The InChIKey is CLCPWTXGFUIRJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,8H2,(H,9,10).
What are the key properties of 7-amino-3H-1,3-benzoxazol-2-one?
7-amino-3H-1,3-benzoxazol-2-one has a molecular weight of 150.14 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 11147814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).