C19H25NO3 — CID 111478844
N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-phenylbutanamide (PubChem CID 111478844) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-phenylbutanamide.
| Compound Name | N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 111478844 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-phenylbutanamide |
| SMILES | Cc1cc(C(C)(O)CNC(=O)CC(C)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C19H25NO3/c1-13(16-8-6-5-7-9-16)10-18(21)20-12-19(4,22)17-11-14(2)23-15(17)3/h5-9,11,13,22H,10,12H2,1-4H3,(H,20,21) |
| InChIKey | YULNYKDQPUJSQN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |