C16H17Cl2NO3 — CID 111479091
2,5-dichloro-N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]benzamide (PubChem CID 111479091) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 111479091 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2,5-dichloro-N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]benzamide |
| SMILES | Cc1cc(C(C)(O)CNC(=O)c2cc(Cl)ccc2Cl)c(C)o1 |
| InChI | InChI=1S/C16H17Cl2NO3/c1-9-6-13(10(2)22-9)16(3,21)8-19-15(20)12-7-11(17)4-5-14(12)18/h4-7,21H,8H2,1-3H3,(H,19,20) |
| InChIKey | YOASXJVNHPWINS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |