About N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide
N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 111480018) has the molecular formula C15H21F3N2O3
and a molecular weight of 334.34 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| PubChem CID | 111480018 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)Cn1cccc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C15H21F3N2O3/c1-10(21)7-14(2,3)9-19-12(22)8-20-6-4-5-11(13(20)23)15(16,17)18/h4-6,10,21H,7-9H2,1-3H3,(H,19,22) |
| InChIKey | KYXVKLXQSDQMAD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide?
The IUPAC name of N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (CID 111480018) is N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
What is the SMILES notation for N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide?
The canonical SMILES for N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide is CC(O)CC(C)(C)CNC(=O)Cn1cccc(C(F)(F)F)c1=O.
What is the InChIKey of N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide?
The InChIKey is KYXVKLXQSDQMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3N2O3/c1-10(21)7-14(2,3)9-19-12(22)8-20-6-4-5-11(13(20)23)15(16,17)18/h4-6,10,21H,7-9H2,1-3H3,(H,19,22).
What are the key properties of N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide?
N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide has a molecular weight of 334.34 g/mol, XLogP of 1.78, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-2,2-dimethylpentyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide is sourced from PubChem (CID 111480018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).