About 4-chloro-6-nitrosobenzene-1,3-diol
4-chloro-6-nitrosobenzene-1,3-diol (PubChem CID 11148011) has the molecular formula C6H4ClNO3
and a molecular weight of 173.56 g/mol. Its IUPAC name is 4-chloro-6-nitrosobenzene-1,3-diol.
Molecular Properties
| Compound Name | 4-chloro-6-nitrosobenzene-1,3-diol |
| PubChem CID | 11148011 |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.56 g/mol |
| Exact Mass | 172.99 |
| IUPAC Name | 4-chloro-6-nitrosobenzene-1,3-diol |
| SMILES | O=Nc1cc(Cl)c(O)cc1O |
| InChI | InChI=1S/C6H4ClNO3/c7-3-1-4(8-11)6(10)2-5(3)9/h1-2,9-10H |
| InChIKey | JVTXZVVELSONAM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-6-nitrosobenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-nitrosobenzene-1,3-diol?
The IUPAC name of 4-chloro-6-nitrosobenzene-1,3-diol (CID 11148011) is 4-chloro-6-nitrosobenzene-1,3-diol.
What is the SMILES notation for 4-chloro-6-nitrosobenzene-1,3-diol?
The canonical SMILES for 4-chloro-6-nitrosobenzene-1,3-diol is O=Nc1cc(Cl)c(O)cc1O.
What is the InChIKey of 4-chloro-6-nitrosobenzene-1,3-diol?
The InChIKey is JVTXZVVELSONAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO3/c7-3-1-4(8-11)6(10)2-5(3)9/h1-2,9-10H.
What are the key properties of 4-chloro-6-nitrosobenzene-1,3-diol?
4-chloro-6-nitrosobenzene-1,3-diol has a molecular weight of 173.56 g/mol, XLogP of 2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-nitrosobenzene-1,3-diol is sourced from PubChem (CID 11148011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).