C20H27NO3 — CID 111480285
N-(4-hydroxy-2,2-dimethylpentyl)-3-(5-phenylfuran-2-yl)propanamide (PubChem CID 111480285) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-3-(5-phenylfuran-2-yl)propanamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-3-(5-phenylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 111480285 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-3-(5-phenylfuran-2-yl)propanamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)CCc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H27NO3/c1-15(22)13-20(2,3)14-21-19(23)12-10-17-9-11-18(24-17)16-7-5-4-6-8-16/h4-9,11,15,22H,10,12-14H2,1-3H3,(H,21,23) |
| InChIKey | CFFMFNLSRNWRQZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |