About adamantane-1,3-dicarbonitrile
adamantane-1,3-dicarbonitrile (PubChem CID 11148137) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is adamantane-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | adamantane-1,3-dicarbonitrile |
| PubChem CID | 11148137 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | adamantane-1,3-dicarbonitrile |
| SMILES | N#CC12CC3CC(C1)CC(C#N)(C3)C2 |
| InChI | InChI=1S/C12H14N2/c13-7-11-2-9-1-10(4-11)5-12(3-9,6-11)8-14/h9-10H,1-6H2 |
| InChIKey | IKQLLMXNIOWBHF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze adamantane-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1,3-dicarbonitrile?
The IUPAC name of adamantane-1,3-dicarbonitrile (CID 11148137) is adamantane-1,3-dicarbonitrile.
What is the SMILES notation for adamantane-1,3-dicarbonitrile?
The canonical SMILES for adamantane-1,3-dicarbonitrile is N#CC12CC3CC(C1)CC(C#N)(C3)C2.
What is the InChIKey of adamantane-1,3-dicarbonitrile?
The InChIKey is IKQLLMXNIOWBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c13-7-11-2-9-1-10(4-11)5-12(3-9,6-11)8-14/h9-10H,1-6H2.
What are the key properties of adamantane-1,3-dicarbonitrile?
adamantane-1,3-dicarbonitrile has a molecular weight of 186.26 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1,3-dicarbonitrile is sourced from PubChem (CID 11148137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).