C15H20N4O5 — CID 111482319
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]propanamide (PubChem CID 111482319) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]propanamide.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]propanamide |
|---|---|
| PubChem CID | 111482319 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]propanamide |
| SMILES | Cc1nn(CCC(=O)NCC(C)(O)c2ccco2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O5/c1-10-14(19(22)23)11(2)18(17-10)7-6-13(20)16-9-15(3,21)12-5-4-8-24-12/h4-5,8,21H,6-7,9H2,1-3H3,(H,16,20) |
| InChIKey | WLOOVJJVTUDXAJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|