C10H14O4 — CID 11148302
methyl (3aS,6S,6aS)-6a-methoxy-2,3,3a,6-tetrahydrocyclopenta[b]furan-6-carboxylate (PubChem CID 11148302) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl (3aS,6S,6aS)-6a-methoxy-2,3,3a,6-tetrahydrocyclopenta[b]furan-6-carboxylate.
| Compound Name | methyl (3aS,6S,6aS)-6a-methoxy-2,3,3a,6-tetrahydrocyclopenta[b]furan-6-carboxylate |
|---|---|
| PubChem CID | 11148302 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | methyl (3aS,6S,6aS)-6a-methoxy-2,3,3a,6-tetrahydrocyclopenta[b]furan-6-carboxylate |
| SMILES | COC(=O)[C@H]1C=C[C@@H]2CCO[C@@]21OC |
| InChI | InChI=1S/C10H14O4/c1-12-9(11)8-4-3-7-5-6-14-10(7,8)13-2/h3-4,7-8H,5-6H2,1-2H3/t7-,8-,10+/m1/s1 |
| InChIKey | AMAHRKVSFHUXFR-MRTMQBJTSA-N |
| XLogP | 0.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|