C17H24N4O2 — CID 111485159
N-(2-hydroxy-2,5-dimethylhexyl)-3-(1,2,4-triazol-1-yl)benzamide (PubChem CID 111485159) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(2-hydroxy-2,5-dimethylhexyl)-3-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(2-hydroxy-2,5-dimethylhexyl)-3-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 111485159 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-(2-hydroxy-2,5-dimethylhexyl)-3-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CC(C)CCC(C)(O)CNC(=O)c1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C17H24N4O2/c1-13(2)7-8-17(3,23)10-19-16(22)14-5-4-6-15(9-14)21-12-18-11-20-21/h4-6,9,11-13,23H,7-8,10H2,1-3H3,(H,19,22) |
| InChIKey | STCCQKRUFANGOG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |