About N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide
N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 111485316) has the molecular formula C16H23F3N2O3
and a molecular weight of 348.37 g/mol. Its IUPAC name is N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| PubChem CID | 111485316 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CC(C)CCC(C)(O)CNC(=O)Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C16H23F3N2O3/c1-11(2)6-7-15(3,24)10-20-13(22)9-21-8-12(16(17,18)19)4-5-14(21)23/h4-5,8,11,24H,6-7,9-10H2,1-3H3,(H,20,22) |
| InChIKey | FHCPTYRHPFPJLW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide?
The IUPAC name of N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (CID 111485316) is N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
What is the SMILES notation for N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide?
The canonical SMILES for N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide is CC(C)CCC(C)(O)CNC(=O)Cn1cc(C(F)(F)F)ccc1=O.
What is the InChIKey of N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide?
The InChIKey is FHCPTYRHPFPJLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F3N2O3/c1-11(2)6-7-15(3,24)10-20-13(22)9-21-8-12(16(17,18)19)4-5-14(21)23/h4-5,8,11,24H,6-7,9-10H2,1-3H3,(H,20,22).
What are the key properties of N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide?
N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide has a molecular weight of 348.37 g/mol, XLogP of 2.17, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-2,5-dimethylhexyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide is sourced from PubChem (CID 111485316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).