About (Z)-tridec-2-ene-1,4-diol
(Z)-tridec-2-ene-1,4-diol (PubChem CID 11148598) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is (Z)-tridec-2-ene-1,4-diol.
Molecular Properties
| Compound Name | (Z)-tridec-2-ene-1,4-diol |
| PubChem CID | 11148598 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (Z)-tridec-2-ene-1,4-diol |
| SMILES | CCCCCCCCCC(O)/C=C\CO |
| InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-10-13(15)11-9-12-14/h9,11,13-15H,2-8,10,12H2,1H3/b11-9- |
| InChIKey | HDRJUSHJFKFCNX-LUAWRHEFSA-N |
| XLogP | 3.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-tridec-2-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-tridec-2-ene-1,4-diol?
The IUPAC name of (Z)-tridec-2-ene-1,4-diol (CID 11148598) is (Z)-tridec-2-ene-1,4-diol.
What is the SMILES notation for (Z)-tridec-2-ene-1,4-diol?
The canonical SMILES for (Z)-tridec-2-ene-1,4-diol is CCCCCCCCCC(O)/C=C\CO.
What is the InChIKey of (Z)-tridec-2-ene-1,4-diol?
The InChIKey is HDRJUSHJFKFCNX-LUAWRHEFSA-N. The full InChI is InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-10-13(15)11-9-12-14/h9,11,13-15H,2-8,10,12H2,1H3/b11-9-.
What are the key properties of (Z)-tridec-2-ene-1,4-diol?
(Z)-tridec-2-ene-1,4-diol has a molecular weight of 214.35 g/mol, XLogP of 3.04, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-tridec-2-ene-1,4-diol is sourced from PubChem (CID 11148598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).