C9H10F2N2O2 — CID 11148620
1-(1,3-dimethylpyrazol-4-yl)-4,4-difluorobutane-1,3-dione (PubChem CID 11148620) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-4,4-difluorobutane-1,3-dione.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-4,4-difluorobutane-1,3-dione |
|---|---|
| PubChem CID | 11148620 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-4,4-difluorobutane-1,3-dione |
| SMILES | Cc1nn(C)cc1C(=O)CC(=O)C(F)F |
| InChI | InChI=1S/C9H10F2N2O2/c1-5-6(4-13(2)12-5)7(14)3-8(15)9(10)11/h4,9H,3H2,1-2H3 |
| InChIKey | LSJYQWHOOBBGSN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|