About 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one
5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one (PubChem CID 11148637) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one.
Molecular Properties
| Compound Name | 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one |
| PubChem CID | 11148637 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one |
| SMILES | CC1=C2C=CC=C2C(=O)C(C)(O)C12CCC2 |
| InChI | InChI=1S/C14H16O2/c1-9-10-5-3-6-11(10)12(15)13(2,16)14(9)7-4-8-14/h3,5-6,16H,4,7-8H2,1-2H3 |
| InChIKey | WJILVVOYZURNCB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one?
The IUPAC name of 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one (CID 11148637) is 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one.
What is the SMILES notation for 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one?
The canonical SMILES for 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one is CC1=C2C=CC=C2C(=O)C(C)(O)C12CCC2.
What is the InChIKey of 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one?
The InChIKey is WJILVVOYZURNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-9-10-5-3-6-11(10)12(15)13(2,16)14(9)7-4-8-14/h3,5-6,16H,4,7-8H2,1-2H3.
What are the key properties of 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one?
5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one has a molecular weight of 216.28 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-hydroxy-5',7'-dimethylspiro[cyclobutane-1,6'-indene]-4'-one is sourced from PubChem (CID 11148637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).