C14H24N2 — CID 11148735
(5S)-N,N-di(propan-2-yl)-4,5,6,7-tetrahydro-1H-indol-5-amine (PubChem CID 11148735) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (5S)-N,N-di(propan-2-yl)-4,5,6,7-tetrahydro-1H-indol-5-amine.
| Compound Name | (5S)-N,N-di(propan-2-yl)-4,5,6,7-tetrahydro-1H-indol-5-amine |
|---|---|
| PubChem CID | 11148735 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (5S)-N,N-di(propan-2-yl)-4,5,6,7-tetrahydro-1H-indol-5-amine |
| SMILES | CC(C)N(C(C)C)[C@H]1CCc2[nH]ccc2C1 |
| InChI | InChI=1S/C14H24N2/c1-10(2)16(11(3)4)13-5-6-14-12(9-13)7-8-15-14/h7-8,10-11,13,15H,5-6,9H2,1-4H3/t13-/m0/s1 |
| InChIKey | AONIKPLIZCZTOZ-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |