C12H18ClNO — CID 111487359
(2R)-1-[(3-chlorophenyl)methyl-methylamino]butan-2-ol (PubChem CID 111487359) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is (2R)-1-[(3-chlorophenyl)methyl-methylamino]butan-2-ol.
| Compound Name | (2R)-1-[(3-chlorophenyl)methyl-methylamino]butan-2-ol |
|---|---|
| PubChem CID | 111487359 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2R)-1-[(3-chlorophenyl)methyl-methylamino]butan-2-ol |
| SMILES | CC[C@@H](O)CN(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H18ClNO/c1-3-12(15)9-14(2)8-10-5-4-6-11(13)7-10/h4-7,12,15H,3,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | LIPJYIJJQKVLCF-GFCCVEGCSA-N |
| XLogP | 2.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |