About 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol
2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 111487788) has the molecular formula C14H17BrN2O3
and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 111487788 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | OCCN(CCO)Cc1ncc(-c2cccc(Br)c2)o1 |
| InChI | InChI=1S/C14H17BrN2O3/c15-12-3-1-2-11(8-12)13-9-16-14(20-13)10-17(4-6-18)5-7-19/h1-3,8-9,18-19H,4-7,10H2 |
| InChIKey | IGIWTCSSBPPEEY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol (CID 111487788) is 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol is OCCN(CCO)Cc1ncc(-c2cccc(Br)c2)o1.
What is the InChIKey of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol?
The InChIKey is IGIWTCSSBPPEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O3/c15-12-3-1-2-11(8-12)13-9-16-14(20-13)10-17(4-6-18)5-7-19/h1-3,8-9,18-19H,4-7,10H2.
What are the key properties of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol?
2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol has a molecular weight of 341.20 g/mol, XLogP of 1.89, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]methyl-(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 111487788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).