C12H17NO3 — CID 11148788
methyl (3E)-3-[(8aS)-3-oxo-6,7,8,8a-tetrahydro-5H-indolizin-1-ylidene]propanoate (PubChem CID 11148788) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl (3E)-3-[(8aS)-3-oxo-6,7,8,8a-tetrahydro-5H-indolizin-1-ylidene]propanoate.
| Compound Name | methyl (3E)-3-[(8aS)-3-oxo-6,7,8,8a-tetrahydro-5H-indolizin-1-ylidene]propanoate |
|---|---|
| PubChem CID | 11148788 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl (3E)-3-[(8aS)-3-oxo-6,7,8,8a-tetrahydro-5H-indolizin-1-ylidene]propanoate |
| SMILES | COC(=O)C/C=C1\CC(=O)N2CCCC[C@@H]12 |
| InChI | InChI=1S/C12H17NO3/c1-16-12(15)6-5-9-8-11(14)13-7-3-2-4-10(9)13/h5,10H,2-4,6-8H2,1H3/b9-5+/t10-/m0/s1 |
| InChIKey | HUMLUJKJKAOZTC-CYNRKNSPSA-N |
| XLogP | 1.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|