About dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate
dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate (PubChem CID 11148842) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate |
| PubChem CID | 11148842 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CCCCC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H18O4/c1-4-9-7-5-6-8-12(9,10(13)15-2)11(14)16-3/h4,9H,1,5-8H2,2-3H3/t9-/m0/s1 |
| InChIKey | DOOUNNGHGFDUSS-VIFPVBQESA-N |
| XLogP | 1.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate?
The IUPAC name of dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate (CID 11148842) is dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate.
What is the SMILES notation for dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate?
The canonical SMILES for dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate is C=C[C@H]1CCCCC1(C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate?
The InChIKey is DOOUNNGHGFDUSS-VIFPVBQESA-N. The full InChI is InChI=1S/C12H18O4/c1-4-9-7-5-6-8-12(9,10(13)15-2)11(14)16-3/h4,9H,1,5-8H2,2-3H3/t9-/m0/s1.
What are the key properties of dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate?
dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate has a molecular weight of 226.27 g/mol, XLogP of 1.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2R)-2-ethenylcyclohexane-1,1-dicarboxylate is sourced from PubChem (CID 11148842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).