C13H22F2N4O — CID 111489336
1-[4-[[1-(Difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-2-ol (PubChem CID 111489336) has the molecular formula C13H22F2N4O and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-2-ol.
| Compound Name | 1-[4-[[1-(Difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 111489336 |
| Molecular Formula | C13H22F2N4O |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-2-ol |
| SMILES | CCC(CN1CCN(CC1)CC2=NC=CN2C(F)F)O |
| InChI | InChI=1S/C13H22F2N4O/c1-2-11(20)9-17-5-7-18(8-6-17)10-12-16-3-4-19(12)13(14)15/h3-4,11,13,20H,2,5-10H2,1H3 |
| InChIKey | YYVUMHRAPACIBY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 44.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 288 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |