C17H28N2O3 — CID 111489429
2-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]butan-1-ol (PubChem CID 111489429) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]butan-1-ol.
| Compound Name | 2-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 111489429 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]butan-1-ol |
| SMILES | CCC(CO)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C17H28N2O3/c1-4-15(13-20)19-9-7-18(8-10-19)12-14-11-16(21-2)5-6-17(14)22-3/h5-6,11,15,20H,4,7-10,12-13H2,1-3H3 |
| InChIKey | USOBMEZWKISBEO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |