C21H27FN2O — CID 111490262
2-[(1-benzylpyrrolidin-3-yl)methyl-methylamino]-1-(4-fluorophenyl)ethanol (PubChem CID 111490262) has the molecular formula C21H27FN2O and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[(1-benzylpyrrolidin-3-yl)methyl-methylamino]-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[(1-benzylpyrrolidin-3-yl)methyl-methylamino]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 111490262 |
| Molecular Formula | C21H27FN2O |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-[(1-benzylpyrrolidin-3-yl)methyl-methylamino]-1-(4-fluorophenyl)ethanol |
| SMILES | CN(CC1CCN(Cc2ccccc2)C1)CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O/c1-23(16-21(25)19-7-9-20(22)10-8-19)13-18-11-12-24(15-18)14-17-5-3-2-4-6-17/h2-10,18,21,25H,11-16H2,1H3 |
| InChIKey | FABYKLONFANGGE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |