About 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide
2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide (PubChem CID 111491029) has the molecular formula C17H23ClN2O3
and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide.
Molecular Properties
| Compound Name | 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide |
| PubChem CID | 111491029 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide |
| SMILES | CC(CCO)CNC(=O)C(=O)N1CC(C)(C)c2c(Cl)cccc21 |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(7-8-21)9-19-15(22)16(23)20-10-17(2,3)14-12(18)5-4-6-13(14)20/h4-6,11,21H,7-10H2,1-3H3,(H,19,22) |
| InChIKey | HOOHEXFQLXMIQF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide?
The IUPAC name of 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide (CID 111491029) is 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide.
What is the SMILES notation for 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide?
The canonical SMILES for 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide is CC(CCO)CNC(=O)C(=O)N1CC(C)(C)c2c(Cl)cccc21.
What is the InChIKey of 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide?
The InChIKey is HOOHEXFQLXMIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN2O3/c1-11(7-8-21)9-19-15(22)16(23)20-10-17(2,3)14-12(18)5-4-6-13(14)20/h4-6,11,21H,7-10H2,1-3H3,(H,19,22).
What are the key properties of 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide?
2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide has a molecular weight of 338.84 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-N-(4-hydroxy-2-methylbutyl)-2-oxoacetamide is sourced from PubChem (CID 111491029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).