C13H20O4 — CID 11149154
2-[(2S,3S,6R)-3-methyl-6-[(E)-2-oxopent-3-enyl]oxan-2-yl]acetic acid (PubChem CID 11149154) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[(2S,3S,6R)-3-methyl-6-[(E)-2-oxopent-3-enyl]oxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,6R)-3-methyl-6-[(E)-2-oxopent-3-enyl]oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 11149154 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[(2S,3S,6R)-3-methyl-6-[(E)-2-oxopent-3-enyl]oxan-2-yl]acetic acid |
| SMILES | C/C=C/C(=O)C[C@H]1CC[C@H](C)[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C13H20O4/c1-3-4-10(14)7-11-6-5-9(2)12(17-11)8-13(15)16/h3-4,9,11-12H,5-8H2,1-2H3,(H,15,16)/b4-3+/t9-,11+,12-/m0/s1 |
| InChIKey | OJWAGOPTFYQKOJ-URNGMLMDSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|