C5Cl2F6 — CID 11149241
1,4-dichloro-2,3,3,4,5,5-hexafluorocyclopentene (PubChem CID 11149241) has the molecular formula C5Cl2F6 and a molecular weight of 244.95 g/mol. Its IUPAC name is 1,4-dichloro-2,3,3,4,5,5-hexafluorocyclopentene.
| Compound Name | 1,4-dichloro-2,3,3,4,5,5-hexafluorocyclopentene |
|---|---|
| PubChem CID | 11149241 |
| Molecular Formula | C5Cl2F6 |
| Molecular Weight | 244.95 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | 1,4-dichloro-2,3,3,4,5,5-hexafluorocyclopentene |
| SMILES | FC1=C(Cl)C(F)(F)C(F)(Cl)C1(F)F |
| InChI | InChI=1S/C5Cl2F6/c6-1-2(8)4(11,12)5(7,13)3(1,9)10 |
| InChIKey | LXTWBLXBEQAHMH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|