C12H16O6 — CID 11149525
dimethyl 2-[(1S,4R)-4-acetyloxycyclopent-2-en-1-yl]propanedioate (PubChem CID 11149525) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is dimethyl 2-[(1S,4R)-4-acetyloxycyclopent-2-en-1-yl]propanedioate.
| Compound Name | dimethyl 2-[(1S,4R)-4-acetyloxycyclopent-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 11149525 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | dimethyl 2-[(1S,4R)-4-acetyloxycyclopent-2-en-1-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1C=C[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C12H16O6/c1-7(13)18-9-5-4-8(6-9)10(11(14)16-2)12(15)17-3/h4-5,8-10H,6H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | YYLAITZVMQJHPW-BDAKNGLRSA-N |
| XLogP | 0.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|