C11H19F4NO — CID 11149554
N,N-dibutyl-2,3,3,3-tetrafluoropropanamide (PubChem CID 11149554) has the molecular formula C11H19F4NO and a molecular weight of 257.27 g/mol. Its IUPAC name is N,N-dibutyl-2,3,3,3-tetrafluoropropanamide.
| Compound Name | N,N-dibutyl-2,3,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 11149554 |
| Molecular Formula | C11H19F4NO |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N,N-dibutyl-2,3,3,3-tetrafluoropropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H19F4NO/c1-3-5-7-16(8-6-4-2)10(17)9(12)11(13,14)15/h9H,3-8H2,1-2H3 |
| InChIKey | IAHPYKODWWCCGT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |