C11H19IN4S — CID 111495609
1-cyclopropyl-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111495609) has the molecular formula C11H19IN4S and a molecular weight of 366.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111495609 |
| Molecular Formula | C11H19IN4S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1-cyclopropyl-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NC1CC1.I |
| InChI | InChI=1S/C11H18N4S.HI/c1-3-12-11(15-9-4-5-9)14-7-10-13-6-8(2)16-10;/h6,9H,3-5,7H2,1-2H3,(H2,12,14,15);1H |
| InChIKey | XICWOXZIJNLDQG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|