C12H22F3IN4O — CID 111495845
2-[(N-cyclopentyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111495845) has the molecular formula C12H22F3IN4O and a molecular weight of 422.23 g/mol. Its IUPAC name is 2-[(N-cyclopentyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[(N-cyclopentyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111495845 |
| Molecular Formula | C12H22F3IN4O |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2-[(N-cyclopentyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)NC1CCCC1.I |
| InChI | InChI=1S/C12H21F3N4O.HI/c1-16-11(18-9-5-3-4-6-9)17-7-10(20)19(2)8-12(13,14)15;/h9H,3-8H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | BOCHEBJUFHLTOT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|