About 2-cyclohex-3-en-1-ylisoindole-1,3-dithione
2-cyclohex-3-en-1-ylisoindole-1,3-dithione (PubChem CID 11149615) has the molecular formula C14H13NS2
and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-ylisoindole-1,3-dithione.
Molecular Properties
| Compound Name | 2-cyclohex-3-en-1-ylisoindole-1,3-dithione |
| PubChem CID | 11149615 |
| Molecular Formula | C14H13NS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-cyclohex-3-en-1-ylisoindole-1,3-dithione |
| SMILES | S=C1c2ccccc2C(=S)N1C1CC=CCC1 |
| InChI | InChI=1S/C14H13NS2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-2,4-5,8-10H,3,6-7H2 |
| InChIKey | GXIXKSMAOXPPGZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohex-3-en-1-ylisoindole-1,3-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohex-3-en-1-ylisoindole-1,3-dithione?
The IUPAC name of 2-cyclohex-3-en-1-ylisoindole-1,3-dithione (CID 11149615) is 2-cyclohex-3-en-1-ylisoindole-1,3-dithione.
What is the SMILES notation for 2-cyclohex-3-en-1-ylisoindole-1,3-dithione?
The canonical SMILES for 2-cyclohex-3-en-1-ylisoindole-1,3-dithione is S=C1c2ccccc2C(=S)N1C1CC=CCC1.
What is the InChIKey of 2-cyclohex-3-en-1-ylisoindole-1,3-dithione?
The InChIKey is GXIXKSMAOXPPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-2,4-5,8-10H,3,6-7H2.
What are the key properties of 2-cyclohex-3-en-1-ylisoindole-1,3-dithione?
2-cyclohex-3-en-1-ylisoindole-1,3-dithione has a molecular weight of 259.40 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohex-3-en-1-ylisoindole-1,3-dithione is sourced from PubChem (CID 11149615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).