C17H24IN3S2 — CID 111496171
2-methyl-1-(2-phenylsulfanylpropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111496171) has the molecular formula C17H24IN3S2 and a molecular weight of 461.44 g/mol. Its IUPAC name is 2-methyl-1-(2-phenylsulfanylpropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-phenylsulfanylpropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111496171 |
| Molecular Formula | C17H24IN3S2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 2-methyl-1-(2-phenylsulfanylpropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccs1)NCC(C)Sc1ccccc1.I |
| InChI | InChI=1S/C17H23N3S2.HI/c1-14(22-16-7-4-3-5-8-16)13-20-17(18-2)19-11-10-15-9-6-12-21-15;/h3-9,12,14H,10-11,13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | VHXMHWPTELDLNN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|