About 1-chloroethenyl dodecanoate
1-chloroethenyl dodecanoate (PubChem CID 11149641) has the molecular formula C14H25ClO2
and a molecular weight of 260.80 g/mol. Its IUPAC name is 1-chloroethenyl dodecanoate.
Molecular Properties
| Compound Name | 1-chloroethenyl dodecanoate |
| PubChem CID | 11149641 |
| Molecular Formula | C14H25ClO2 |
| Molecular Weight | 260.80 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-chloroethenyl dodecanoate |
| SMILES | C=C(Cl)OC(=O)CCCCCCCCCCC |
| InChI | InChI=1S/C14H25ClO2/c1-3-4-5-6-7-8-9-10-11-12-14(16)17-13(2)15/h2-12H2,1H3 |
| InChIKey | WJNWXLUSSBBIPC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.80 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethenyl dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethenyl dodecanoate?
The IUPAC name of 1-chloroethenyl dodecanoate (CID 11149641) is 1-chloroethenyl dodecanoate.
What is the SMILES notation for 1-chloroethenyl dodecanoate?
The canonical SMILES for 1-chloroethenyl dodecanoate is C=C(Cl)OC(=O)CCCCCCCCCCC.
What is the InChIKey of 1-chloroethenyl dodecanoate?
The InChIKey is WJNWXLUSSBBIPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25ClO2/c1-3-4-5-6-7-8-9-10-11-12-14(16)17-13(2)15/h2-12H2,1H3.
What are the key properties of 1-chloroethenyl dodecanoate?
1-chloroethenyl dodecanoate has a molecular weight of 260.80 g/mol, XLogP of 5.16, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethenyl dodecanoate is sourced from PubChem (CID 11149641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).