About 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine
2-nonylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 11149670) has the molecular formula C14H23N5
and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 11149670 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCCCCCCn1cc2c(N)ncnc2n1 |
| InChI | InChI=1S/C14H23N5/c1-2-3-4-5-6-7-8-9-19-10-12-13(15)16-11-17-14(12)18-19/h10-11H,2-9H2,1H3,(H2,15,16,17,18) |
| InChIKey | JSEZJCXBVBSVHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine (CID 11149670) is 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine is CCCCCCCCCn1cc2c(N)ncnc2n1.
What is the InChIKey of 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is JSEZJCXBVBSVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5/c1-2-3-4-5-6-7-8-9-19-10-12-13(15)16-11-17-14(12)18-19/h10-11H,2-9H2,1H3,(H2,15,16,17,18).
What are the key properties of 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine?
2-nonylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 261.37 g/mol, XLogP of 3.16, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 11149670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).