C18H21N3O2S — CID 111497107
N-(3-cyanothiophen-2-yl)-2-[ethyl-[2-hydroxy-2-(4-methylphenyl)ethyl]amino]acetamide (PubChem CID 111497107) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[ethyl-[2-hydroxy-2-(4-methylphenyl)ethyl]amino]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[ethyl-[2-hydroxy-2-(4-methylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 111497107 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[ethyl-[2-hydroxy-2-(4-methylphenyl)ethyl]amino]acetamide |
| SMILES | CCN(CC(=O)Nc1sccc1C#N)CC(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-21(11-16(22)14-6-4-13(2)5-7-14)12-17(23)20-18-15(10-19)8-9-24-18/h4-9,16,22H,3,11-12H2,1-2H3,(H,20,23) |
| InChIKey | VOKMXPUDSDZDLJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |