C24H42IN5O — CID 111497360
1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111497360) has the molecular formula C24H42IN5O and a molecular weight of 543.54 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111497360 |
| Molecular Formula | C24H42IN5O |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCCCC2)CCN(C)CC1)NCCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H41N5O.HI/c1-4-25-23(26-15-12-21-8-10-22(30-3)11-9-21)27-20-24(13-18-28(2)19-14-24)29-16-6-5-7-17-29;/h8-11H,4-7,12-20H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | VUMMWFCCQRQPFS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|