C15H23NO3 — CID 11149770
ethyl (2S,5S,6S)-5-methyl-4-oxo-1,6-bis(prop-2-enyl)piperidine-2-carboxylate (PubChem CID 11149770) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is ethyl (2S,5S,6S)-5-methyl-4-oxo-1,6-bis(prop-2-enyl)piperidine-2-carboxylate.
| Compound Name | ethyl (2S,5S,6S)-5-methyl-4-oxo-1,6-bis(prop-2-enyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 11149770 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | ethyl (2S,5S,6S)-5-methyl-4-oxo-1,6-bis(prop-2-enyl)piperidine-2-carboxylate |
| SMILES | C=CC[C@H]1[C@H](C)C(=O)C[C@@H](C(=O)OCC)N1CC=C |
| InChI | InChI=1S/C15H23NO3/c1-5-8-12-11(4)14(17)10-13(15(18)19-7-3)16(12)9-6-2/h5-6,11-13H,1-2,7-10H2,3-4H3/t11-,12-,13-/m0/s1 |
| InChIKey | UNCAUDWQFZWAOT-AVGNSLFASA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|