C14H18F3N3O — CID 111498118
N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111498118) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111498118 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1c(F)cccc1OC(F)F)N1CCCC1 |
| InChI | InChI=1S/C14H18F3N3O/c1-18-14(20-7-2-3-8-20)19-9-10-11(15)5-4-6-12(10)21-13(16)17/h4-6,13H,2-3,7-9H2,1H3,(H,18,19) |
| InChIKey | DSZJXCKNVPPEIJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|