C9H11F3IN3O — CID 111498125
2-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]guanidine;hydroiodide (PubChem CID 111498125) has the molecular formula C9H11F3IN3O and a molecular weight of 361.11 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111498125 |
| Molecular Formula | C9H11F3IN3O |
| Molecular Weight | 361.11 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCc1c(F)cccc1OC(F)F |
| InChI | InChI=1S/C9H10F3N3O.HI/c10-6-2-1-3-7(16-8(11)12)5(6)4-15-9(13)14;/h1-3,8H,4H2,(H4,13,14,15);1H |
| InChIKey | XKQYOPOZDXBHOC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.11 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|