About 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine
2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine (PubChem CID 111498158) has the molecular formula C13H18ClF2N3O
and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine.
Molecular Properties
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine |
| PubChem CID | 111498158 |
| Molecular Formula | C13H18ClF2N3O |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCc1cc(Cl)ccc1OC(F)F)NCC |
| InChI | InChI=1S/C13H18ClF2N3O/c1-3-17-13(18-4-2)19-8-9-7-10(14)5-6-11(9)20-12(15)16/h5-7,12H,3-4,8H2,1-2H3,(H2,17,18,19) |
| InChIKey | MATWUKMHVBSPMJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine?
The IUPAC name of 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine (CID 111498158) is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine.
What is the SMILES notation for 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine?
The canonical SMILES for 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine is CCNC(=NCc1cc(Cl)ccc1OC(F)F)NCC.
What is the InChIKey of 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine?
The InChIKey is MATWUKMHVBSPMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClF2N3O/c1-3-17-13(18-4-2)19-8-9-7-10(14)5-6-11(9)20-12(15)16/h5-7,12H,3-4,8H2,1-2H3,(H2,17,18,19).
What are the key properties of 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine?
2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine has a molecular weight of 305.76 g/mol, XLogP of 3.02, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1,3-diethylguanidine is sourced from PubChem (CID 111498158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).