C11H14ClF2N3O — CID 111498162
1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2,3-dimethylguanidine (PubChem CID 111498162) has the molecular formula C11H14ClF2N3O and a molecular weight of 277.70 g/mol. Its IUPAC name is 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2,3-dimethylguanidine.
| Compound Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 111498162 |
| Molecular Formula | C11H14ClF2N3O |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C11H14ClF2N3O/c1-15-11(16-2)17-6-7-5-8(12)3-4-9(7)18-10(13)14/h3-5,10H,6H2,1-2H3,(H2,15,16,17) |
| InChIKey | UHBMYANKHLTBRR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|