C14H20O5 — CID 11149842
[(Z,1S,4S)-1-hydroxy-1-[(2S)-5-oxo-2H-furan-2-yl]oct-2-en-4-yl] acetate (PubChem CID 11149842) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is [(Z,1S,4S)-1-hydroxy-1-[(2S)-5-oxo-2H-furan-2-yl]oct-2-en-4-yl] acetate.
| Compound Name | [(Z,1S,4S)-1-hydroxy-1-[(2S)-5-oxo-2H-furan-2-yl]oct-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 11149842 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [(Z,1S,4S)-1-hydroxy-1-[(2S)-5-oxo-2H-furan-2-yl]oct-2-en-4-yl] acetate |
| SMILES | CCCC[C@@H](/C=C\[C@H](O)[C@@H]1C=CC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C14H20O5/c1-3-4-5-11(18-10(2)15)6-7-12(16)13-8-9-14(17)19-13/h6-9,11-13,16H,3-5H2,1-2H3/b7-6-/t11-,12-,13-/m0/s1 |
| InChIKey | MHFMZMUZMCAZGK-MGTGEQGZSA-N |
| XLogP | 1.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|