C15H24O4 — CID 11149854
(3R,3aS,4R,7aR)-3-methoxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one (PubChem CID 11149854) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3R,3aS,4R,7aR)-3-methoxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one.
| Compound Name | (3R,3aS,4R,7aR)-3-methoxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one |
|---|---|
| PubChem CID | 11149854 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3R,3aS,4R,7aR)-3-methoxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one |
| SMILES | CO[C@@H]1OC[C@@H]2CCC(=O)[C@](C)(CCC(C)=O)[C@]21C |
| InChI | InChI=1S/C15H24O4/c1-10(16)7-8-14(2)12(17)6-5-11-9-19-13(18-4)15(11,14)3/h11,13H,5-9H2,1-4H3/t11-,13+,14-,15+/m0/s1 |
| InChIKey | HQNLYMYOWRRWQM-PMOUVXMZSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |