C18H26N2O2 — CID 111498735
3-[[(2,2-diethyl-4-hydroxybutyl)amino]methyl]-1H-quinolin-2-one (PubChem CID 111498735) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[[(2,2-diethyl-4-hydroxybutyl)amino]methyl]-1H-quinolin-2-one.
| Compound Name | 3-[[(2,2-diethyl-4-hydroxybutyl)amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 111498735 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-[[(2,2-diethyl-4-hydroxybutyl)amino]methyl]-1H-quinolin-2-one |
| SMILES | CCC(CC)(CCO)CNCc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C18H26N2O2/c1-3-18(4-2,9-10-21)13-19-12-15-11-14-7-5-6-8-16(14)20-17(15)22/h5-8,11,19,21H,3-4,9-10,12-13H2,1-2H3,(H,20,22) |
| InChIKey | NOGZFLSQBDYEEG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |