C19H28ClN3O3 — CID 111499831
ethyl 1-[N-[2-(3-chlorophenyl)-2-methoxyethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate (PubChem CID 111499831) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is ethyl 1-[N-[2-(3-chlorophenyl)-2-methoxyethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-[2-(3-chlorophenyl)-2-methoxyethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 111499831 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | ethyl 1-[N-[2-(3-chlorophenyl)-2-methoxyethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCC(OC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H28ClN3O3/c1-4-26-18(24)15-8-6-10-23(13-15)19(21-2)22-12-17(25-3)14-7-5-9-16(20)11-14/h5,7,9,11,15,17H,4,6,8,10,12-13H2,1-3H3,(H,21,22) |
| InChIKey | XXRQCWPKHZAAEA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|