C11H21F3N4O — CID 111499979
2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111499979) has the molecular formula C11H21F3N4O and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111499979 |
| Molecular Formula | C11H21F3N4O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NC(C)C |
| InChI | InChI=1S/C11H21F3N4O/c1-5-15-10(17-8(2)3)16-6-9(19)18(4)7-11(12,13)14/h8H,5-7H2,1-4H3,(H2,15,16,17) |
| InChIKey | SRARHJYHHQPTGP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|