C14H25IN4O3 — CID 111500018
1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111500018) has the molecular formula C14H25IN4O3 and a molecular weight of 424.28 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111500018 |
| Molecular Formula | C14H25IN4O3 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1C(=O)CCCC1=O)NCC1CCCO1.I |
| InChI | InChI=1S/C14H24N4O3.HI/c1-15-14(17-10-11-4-3-9-21-11)16-7-8-18-12(19)5-2-6-13(18)20;/h11H,2-10H2,1H3,(H2,15,16,17);1H |
| InChIKey | PTHPTLLBNXEPPN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|