C16H26ClN3O — CID 111500141
1-butyl-3-[2-(3-chlorophenyl)-2-methoxyethyl]-1,2-dimethylguanidine (PubChem CID 111500141) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is 1-butyl-3-[2-(3-chlorophenyl)-2-methoxyethyl]-1,2-dimethylguanidine.
| Compound Name | 1-butyl-3-[2-(3-chlorophenyl)-2-methoxyethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111500141 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-butyl-3-[2-(3-chlorophenyl)-2-methoxyethyl]-1,2-dimethylguanidine |
| SMILES | CCCCN(C)/C(=N\C)NCC(OC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H26ClN3O/c1-5-6-10-20(3)16(18-2)19-12-15(21-4)13-8-7-9-14(17)11-13/h7-9,11,15H,5-6,10,12H2,1-4H3,(H,18,19) |
| InChIKey | BKTYADOJWLRBTK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|