About N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide
N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111500469) has the molecular formula C10H19F3N4O
and a molecular weight of 268.28 g/mol. Its IUPAC name is N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide.
Molecular Properties
| Compound Name | N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide |
| PubChem CID | 111500469 |
| Molecular Formula | C10H19F3N4O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCN/C(=N\C)NCC(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C10H19F3N4O/c1-4-5-15-9(14-2)16-6-8(18)17(3)7-10(11,12)13/h4-7H2,1-3H3,(H2,14,15,16) |
| InChIKey | CJDKARXBUDQOPX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide?
The IUPAC name of N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide (CID 111500469) is N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide.
What is the SMILES notation for N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide?
The canonical SMILES for N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide is CCCN/C(=N\C)NCC(=O)N(C)CC(F)(F)F.
What is the InChIKey of N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide?
The InChIKey is CJDKARXBUDQOPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N4O/c1-4-5-15-9(14-2)16-6-8(18)17(3)7-10(11,12)13/h4-7H2,1-3H3,(H2,14,15,16).
What are the key properties of N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide?
N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide has a molecular weight of 268.28 g/mol, XLogP of 0.58, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(N'-methyl-N-propylcarbamimidoyl)amino]-N-(2,2,2-trifluoroethyl)acetamide is sourced from PubChem (CID 111500469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).