About (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine
(1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine (PubChem CID 11150055) has the molecular formula C16H18ClNO
and a molecular weight of 275.78 g/mol. Its IUPAC name is (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine.
Molecular Properties
| Compound Name | (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine |
| PubChem CID | 11150055 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine |
| SMILES | Cc1cc(Cl)cc(C)c1OC[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C16H18ClNO/c1-11-8-14(17)9-12(2)16(11)19-10-15(18)13-6-4-3-5-7-13/h3-9,15H,10,18H2,1-2H3/t15-/m1/s1 |
| InChIKey | CBPCNTPWANLULL-OAHLLOKOSA-N |
| XLogP | 4.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine?
The IUPAC name of (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine (CID 11150055) is (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine.
What is the SMILES notation for (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine?
The canonical SMILES for (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine is Cc1cc(Cl)cc(C)c1OC[C@@H](N)c1ccccc1.
What is the InChIKey of (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine?
The InChIKey is CBPCNTPWANLULL-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H18ClNO/c1-11-8-14(17)9-12(2)16(11)19-10-15(18)13-6-4-3-5-7-13/h3-9,15H,10,18H2,1-2H3/t15-/m1/s1.
What are the key properties of (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine?
(1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine has a molecular weight of 275.78 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-(4-chloro-2,6-dimethylphenoxy)-1-phenylethanamine is sourced from PubChem (CID 11150055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).